পিগমেন্ট হলুদ 151-করিম্যাক্স হলুদ এইচ 4 জি
Technical parameters of Pigment yellow 151
| রঙ সূচক নং | পিগমেন্ট হলুদ 151 |
| পণ্যের নাম | Corimax Yellow H4G |
| পণ্য তালিকা | জৈব রঙ্গক |
| সি.এ.এস. নম্বর | 31837-42-0 |
| EU নম্বর | 250-830-4 |
| রাসায়নিক পরিবার | মনো আজো |
| আণবিক ভর | 381.34 |
| আণবিক সূত্র | C18H15N5O5 |
| পিএইচ মান | 7 |
| ঘনত্ব | 1.6 |
| তেল শোষণ (মিলি / 100 গ্রাম)% | 45 |
| হালকা দৃness়তা (আবরণ) | 6-7 |
| তাপ প্রতিরোধের (লেপ) | 200 |
| হালকা দৃness়তা (প্লাস্টিক) | 7-8 |
| তাপ প্রতিরোধের (প্লাস্টিক) | 260 |
| পানি প্রতিরোধী | 5 |
| তেল প্রতিরোধের | 5 |
| অ্যাসিড প্রতিরোধের | 5 |
| ক্ষার প্রতিরোধের | 5 |
রঙ | ![]() |
| হিউ বিতরণ |
আণবিক কাঠামো:

অ্যাপ্লিকেশন:
Recommended for automotive paints, architectural coatings, coil coatings, industrial paints, powder coatings, printing pastes, PVC, rubber, PS, PP, PE, PU, water based inks, solvent inks, UV inks.
অফসেট কালি ব্যবহার করা যেতে পারে।
সংশ্লিষ্ট তথ্য
Pigment yellow 151 gives a hue that is greener than CI Pigment Yellow 154 and redder than Pigment Yellow 175. The hue angle is 97.4 degrees (1 / 3SD). The specific surface area of Hostaperm Yellow H4G is 23m2 / g, which has good hiding power. The fastness is excellent. The coloring sample of alkyd trinitrile resin is exposed to Florida for 1 year. The weather fastness has a grade 5 gray card, and the dilute color (1; 3TiO2) is still grade 4; 1/3 The heat resistance stability of HDPE in standard depth is 260 ° C / 5min; it is suitable for high-end industrial coatings, automotive primers (OEM), and can be combined with phthalocyanines and inorganic pigments, and can also be used for printing polyester laminated plastic films Ink coloring.
aliases:13980; Benzoic acid, 2-(2-(1-(((2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)amino)carbonyl)-2-oxopropyl)diazenyl)-; pigment yellow 151; 2-[[1-[[(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)amino]carbonyl]-2-oxopropyl]azo]benzoic acid; C.I. 13980; fast yellow h4g; 2-[2-OXO-1-[(2-OXO-1,3-DIHYDROBENZOIMIDAZOL-5-YL)CARBAMOY; PROPYL]DIAZENYLBENZOIC ACID; Benzoic acid, 2-1-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)aminocarbonyl-2-oxopropylazo-; BENZIMIDAZOLONE YELLOS H4G; Benzimidazolone Yellow H4G(Pigment Yellow 151); 2-[(E)-{1,3-dioxo-1-[(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)amino]butan-2-yl}diazenyl]benzoic acid; 2-[2-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamoyl]propyl]azobenzoic acid.
IUPAC Name: 2-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]benzoic acid
InChI : InChI=1S/C18H15N5O5/c1-9(24)15(23-22-12-5-3-2-4-11(12)17(26)27)16(25)19-10-6-7-13-14(8-10)21-18(28)20-13/h2-8,15H,1H3,(H,19,25)(H,26,27)(H2,20,21,28)
InChIKey: YMFWVWDPPIWORA-UHFFFAOYSA-N
Canonical SMILES: CC(=O)C(C(=O)NC1=CC2=C(C=C1)NC(=O)N2)N=NC3=CC=CC=C3C(=O)O
রাসায়নিক এবং ভৌত বৈশিষ্ট্য
গণনাকৃত বৈশিষ্ট্য
| সম্পত্তির নাম | সম্পত্তির মূল্য |
| আণবিক ভর | 381.3 g/mol |
| XLogP3-AA | 1.7 |
| হাইড্রোজেন বন্ড দাতা সংখ্যা | 4 |
| হাইড্রোজেন বন্ধন গ্রহণকারীর সংখ্যা | 7 |
| ঘূর্ণনযোগ্য বন্ড সংখ্যা | 6 |
| সঠিক ভর | 381.10731860 g/mol |
| মনোআইসোটোপিক ভর | 381.10731860 g/mol |
| টপোলজিক্যাল পোলার পৃষ্ঠের ক্ষেত্রফল | 149Ų |
| ভারী পরমাণুর সংখ্যা | 28 |
| আনুষ্ঠানিক অভিযোগ | 0 |
| জটিলতা | 681 |
| আইসোটোপ পরমাণু গণনা | 0 |
| সংজ্ঞায়িত পরমাণু স্টেরিওসেন্টার সংখ্যা | 0 |
| অনির্ধারিত পরমাণু স্টেরিওসেন্টার সংখ্যা | 1 |
| সংজ্ঞায়িত বন্ড স্টেরিওসেন্টার গণনা | 0 |
| অসংজ্ঞায়িত বন্ড স্টেরিওসেন্টার গণনা | 0 |
| সমযোজী বন্ধনযুক্ত একক সংখ্যা | 1 |
| যৌগটি ক্যানোনিকালাইজড | হ্যাঁ |
Handling and storage:
Handling
Advice on protection against fire and explosion
Keep away from sources of ignition
Avoid formation of dust
Take precautionary measures against electrostatic loading
Storage
Be kept in a ventilated, cool and dry place, it should be also avoided to contact with acid material and expose to air. Keep container dry
ভিডিও:











